C22H23N3O5 — CID 146000177
2-quinolin-6-yloxy-N-[(E)-[3,4,5-tris(hydroxymethyl)phenyl]methylideneamino]propanamide (PubChem CID 146000177) has the molecular formula C22H23N3O5 and a molecular weight of 409.44 g/mol. Its IUPAC name is 2-quinolin-6-yloxy-N-[(E)-[3,4,5-tris(hydroxymethyl)phenyl]methylideneamino]propanamide.
| Compound Name | 2-quinolin-6-yloxy-N-[(E)-[3,4,5-tris(hydroxymethyl)phenyl]methylideneamino]propanamide |
|---|---|
| PubChem CID | 146000177 |
| Molecular Formula | C22H23N3O5 |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | 2-quinolin-6-yloxy-N-[(E)-[3,4,5-tris(hydroxymethyl)phenyl]methylideneamino]propanamide |
| SMILES | CC(Oc1ccc2ncccc2c1)C(=O)N/N=C/c1cc(CO)c(CO)c(CO)c1 |
| InChI | InChI=1S/C22H23N3O5/c1-14(30-19-4-5-21-16(9-19)3-2-6-23-21)22(29)25-24-10-15-7-17(11-26)20(13-28)18(8-15)12-27/h2-10,14,26-28H,11-13H2,1H3,(H,25,29)/b24-10+ |
| InChIKey | CAQMZGJXKMKRHA-YSURURNPSA-N |
| XLogP | 1.63 |
| TPSA | 124.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|