C22H22BrN5O3 — CID 146000825
ethyl 2-[[2-[4-[(3-bromobenzoyl)amino]anilino]-6-methylpyrimidin-4-yl]amino]acetate (PubChem CID 146000825) has the molecular formula C22H22BrN5O3 and a molecular weight of 484.35 g/mol. Its IUPAC name is ethyl 2-[[2-[4-[(3-bromobenzoyl)amino]anilino]-6-methylpyrimidin-4-yl]amino]acetate.
| Compound Name | ethyl 2-[[2-[4-[(3-bromobenzoyl)amino]anilino]-6-methylpyrimidin-4-yl]amino]acetate |
|---|---|
| PubChem CID | 146000825 |
| Molecular Formula | C22H22BrN5O3 |
| Molecular Weight | 484.35 g/mol |
| Exact Mass | 483.09 |
| IUPAC Name | ethyl 2-[[2-[4-[(3-bromobenzoyl)amino]anilino]-6-methylpyrimidin-4-yl]amino]acetate |
| SMILES | CCOC(=O)CNc1cc(C)nc(Nc2ccc(NC(=O)c3cccc(Br)c3)cc2)n1 |
| InChI | InChI=1S/C22H22BrN5O3/c1-3-31-20(29)13-24-19-11-14(2)25-22(28-19)27-18-9-7-17(8-10-18)26-21(30)15-5-4-6-16(23)12-15/h4-12H,3,13H2,1-2H3,(H,26,30)(H2,24,25,27,28) |
| InChIKey | ODPRLRXESNMBOR-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 105.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.35 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |