C17H26NO5P — CID 146000844
N-[(E)-3-diethoxyphosphorylprop-2-enyl]-N-hydroxy-4-phenylbutanamide (PubChem CID 146000844) has the molecular formula C17H26NO5P and a molecular weight of 355.37 g/mol. Its IUPAC name is N-[(E)-3-diethoxyphosphorylprop-2-enyl]-N-hydroxy-4-phenylbutanamide.
| Compound Name | N-[(E)-3-diethoxyphosphorylprop-2-enyl]-N-hydroxy-4-phenylbutanamide |
|---|---|
| PubChem CID | 146000844 |
| Molecular Formula | C17H26NO5P |
| Molecular Weight | 355.37 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | N-[(E)-3-diethoxyphosphorylprop-2-enyl]-N-hydroxy-4-phenylbutanamide |
| SMILES | CCOP(=O)(/C=C/CN(O)C(=O)CCCc1ccccc1)OCC |
| InChI | InChI=1S/C17H26NO5P/c1-3-22-24(21,23-4-2)15-9-14-18(20)17(19)13-8-12-16-10-6-5-7-11-16/h5-7,9-11,15,20H,3-4,8,12-14H2,1-2H3/b15-9+ |
| InChIKey | NWKTYSZZVDDODT-OQLLNIDSSA-N |
| XLogP | 4.01 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.37 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|