C32H51N2O10P2+ — CID 123314629
diethoxy-[[ethoxy-[3-[hydroxy(3-phenylpropanoyl)amino]propyl]phosphoryl]oxymethoxy]-[3-[hydroxy(4-phenylbutanoyl)amino]propyl]phosphanium (PubChem CID 123314629) has the molecular formula C32H51N2O10P2+ and a molecular weight of 685.71 g/mol. Its IUPAC name is diethoxy-[[ethoxy-[3-[hydroxy(3-phenylpropanoyl)amino]propyl]phosphoryl]oxymethoxy]-[3-[hydroxy(4-phenylbutanoyl)amino]propyl]phosphanium.
| Compound Name | diethoxy-[[ethoxy-[3-[hydroxy(3-phenylpropanoyl)amino]propyl]phosphoryl]oxymethoxy]-[3-[hydroxy(4-phenylbutanoyl)amino]propyl]phosphanium |
|---|---|
| PubChem CID | 123314629 |
| Molecular Formula | C32H51N2O10P2+ |
| Molecular Weight | 685.71 g/mol |
| Exact Mass | 685.30 |
| IUPAC Name | diethoxy-[[ethoxy-[3-[hydroxy(3-phenylpropanoyl)amino]propyl]phosphoryl]oxymethoxy]-[3-[hydroxy(4-phenylbutanoyl)amino]propyl]phosphanium |
| SMILES | CCOP(=O)(CCCN(O)C(=O)CCc1ccccc1)OCO[P+](CCCN(O)C(=O)CCCc1ccccc1)(OCC)OCC |
| InChI | InChI=1S/C32H51N2O10P2/c1-4-40-45(39,26-14-24-34(38)32(36)23-22-30-18-11-8-12-19-30)43-28-44-46(41-5-2,42-6-3)27-15-25-33(37)31(35)21-13-20-29-16-9-7-10-17-29/h7-12,16-19,37-38H,4-6,13-15,20-28H2,1-3H3/q+1 |
| InChIKey | JRFVBOGBPJDPSJ-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 144.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.71 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|