C20H21F3N4O5 — CID 146000948
2-[4-(cyclohexylmethyl)-3-oxopiperazin-1-yl]-8-nitro-6-(trifluoromethyl)-1,3-benzoxazin-4-one (PubChem CID 146000948) has the molecular formula C20H21F3N4O5 and a molecular weight of 454.41 g/mol. Its IUPAC name is 2-[4-(cyclohexylmethyl)-3-oxopiperazin-1-yl]-8-nitro-6-(trifluoromethyl)-1,3-benzoxazin-4-one.
| Compound Name | 2-[4-(cyclohexylmethyl)-3-oxopiperazin-1-yl]-8-nitro-6-(trifluoromethyl)-1,3-benzoxazin-4-one |
|---|---|
| PubChem CID | 146000948 |
| Molecular Formula | C20H21F3N4O5 |
| Molecular Weight | 454.41 g/mol |
| Exact Mass | 454.15 |
| IUPAC Name | 2-[4-(cyclohexylmethyl)-3-oxopiperazin-1-yl]-8-nitro-6-(trifluoromethyl)-1,3-benzoxazin-4-one |
| SMILES | O=C1CN(c2nc(=O)c3cc(C(F)(F)F)cc([N+](=O)[O-])c3o2)CCN1CC1CCCCC1 |
| InChI | InChI=1S/C20H21F3N4O5/c21-20(22,23)13-8-14-17(15(9-13)27(30)31)32-19(24-18(14)29)26-7-6-25(16(28)11-26)10-12-4-2-1-3-5-12/h8-9,12H,1-7,10-11H2 |
| InChIKey | VILLAHMIFDXBNA-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 109.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.41 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|