C32H25N3O4 — CID 146001223
3-[[6-[1-[(3-methoxycarbonylphenyl)methyl]indazol-6-yl]indol-1-yl]methyl]benzoic acid (PubChem CID 146001223) has the molecular formula C32H25N3O4 and a molecular weight of 515.57 g/mol. Its IUPAC name is 3-[[6-[1-[(3-methoxycarbonylphenyl)methyl]indazol-6-yl]indol-1-yl]methyl]benzoic acid.
| Compound Name | 3-[[6-[1-[(3-methoxycarbonylphenyl)methyl]indazol-6-yl]indol-1-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 146001223 |
| Molecular Formula | C32H25N3O4 |
| Molecular Weight | 515.57 g/mol |
| Exact Mass | 515.18 |
| IUPAC Name | 3-[[6-[1-[(3-methoxycarbonylphenyl)methyl]indazol-6-yl]indol-1-yl]methyl]benzoic acid |
| SMILES | COC(=O)c1cccc(Cn2ncc3ccc(-c4ccc5ccn(Cc6cccc(C(=O)O)c6)c5c4)cc32)c1 |
| InChI | InChI=1S/C32H25N3O4/c1-39-32(38)27-7-3-5-22(15-27)20-35-30-17-25(10-11-28(30)18-33-35)24-9-8-23-12-13-34(29(23)16-24)19-21-4-2-6-26(14-21)31(36)37/h2-18H,19-20H2,1H3,(H,36,37) |
| InChIKey | OWEONJFWUSDZMK-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 86.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.57 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |