C35H56O8 — CID 146001393
[2-methyl-6-[(5R,7R,8R,9S,14S,17R)-3,7,16-triacetyloxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]heptyl] acetate (PubChem CID 146001393) has the molecular formula C35H56O8 and a molecular weight of 604.83 g/mol. Its IUPAC name is [2-methyl-6-[(5R,7R,8R,9S,14S,17R)-3,7,16-triacetyloxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]heptyl] acetate.
| Compound Name | [2-methyl-6-[(5R,7R,8R,9S,14S,17R)-3,7,16-triacetyloxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]heptyl] acetate |
|---|---|
| PubChem CID | 146001393 |
| Molecular Formula | C35H56O8 |
| Molecular Weight | 604.83 g/mol |
| Exact Mass | 604.40 |
| IUPAC Name | [2-methyl-6-[(5R,7R,8R,9S,14S,17R)-3,7,16-triacetyloxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]heptyl] acetate |
| SMILES | CC(=O)OCC(C)CCCC(C)[C@H]1C(OC(C)=O)C[C@H]2[C@@H]3[C@H](OC(C)=O)C[C@H]4CC(OC(C)=O)CCC4(C)[C@H]3CCC12C |
| InChI | InChI=1S/C35H56O8/c1-20(19-40-22(3)36)10-9-11-21(2)33-31(43-25(6)39)18-29-32-28(13-15-35(29,33)8)34(7)14-12-27(41-23(4)37)16-26(34)17-30(32)42-24(5)38/h20-21,26-33H,9-19H2,1-8H3/t20?,21?,26-,27?,28+,29+,30-,31?,32-,33+,34?,35?/m1/s1 |
| InChIKey | FQSTXEWGPYKNPY-CBXYKBCHSA-N |
| XLogP | 6.67 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.83 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|