C16H23NO — CID 146003610
3-(2-methoxyphenyl)-N,N-dipropylprop-2-yn-1-amine (PubChem CID 146003610) has the molecular formula C16H23NO and a molecular weight of 245.37 g/mol. Its IUPAC name is 3-(2-methoxyphenyl)-N,N-dipropylprop-2-yn-1-amine.
| Compound Name | 3-(2-methoxyphenyl)-N,N-dipropylprop-2-yn-1-amine |
|---|---|
| PubChem CID | 146003610 |
| Molecular Formula | C16H23NO |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.18 |
| IUPAC Name | 3-(2-methoxyphenyl)-N,N-dipropylprop-2-yn-1-amine |
| SMILES | CCCN(CC#Cc1ccccc1OC)CCC |
| InChI | InChI=1S/C16H23NO/c1-4-12-17(13-5-2)14-8-10-15-9-6-7-11-16(15)18-3/h6-7,9,11H,4-5,12-14H2,1-3H3 |
| InChIKey | HRFNCXYTXYJOGR-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|