C14H9Cl2FO — CID 146006688
2,2-dichloro-1-(3-fluoro-4-phenylphenyl)ethanone (PubChem CID 146006688) has the molecular formula C14H9Cl2FO and a molecular weight of 283.13 g/mol. Its IUPAC name is 2,2-dichloro-1-(3-fluoro-4-phenylphenyl)ethanone.
| Compound Name | 2,2-dichloro-1-(3-fluoro-4-phenylphenyl)ethanone |
|---|---|
| PubChem CID | 146006688 |
| Molecular Formula | C14H9Cl2FO |
| Molecular Weight | 283.13 g/mol |
| Exact Mass | 282.00 |
| IUPAC Name | 2,2-dichloro-1-(3-fluoro-4-phenylphenyl)ethanone |
| SMILES | O=C(c1ccc(-c2ccccc2)c(F)c1)C(Cl)Cl |
| InChI | InChI=1S/C14H9Cl2FO/c15-14(16)13(18)10-6-7-11(12(17)8-10)9-4-2-1-3-5-9/h1-8,14H |
| InChIKey | QXMQHYJZALSZBP-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.13 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|