C8H2BrF7OS — CID 146008454
1-(4-bromothiophen-2-yl)-2,2,3,3,4,4,4-heptafluorobutan-1-one (PubChem CID 146008454) has the molecular formula C8H2BrF7OS and a molecular weight of 359.06 g/mol. Its IUPAC name is 1-(4-bromothiophen-2-yl)-2,2,3,3,4,4,4-heptafluorobutan-1-one.
| Compound Name | 1-(4-bromothiophen-2-yl)-2,2,3,3,4,4,4-heptafluorobutan-1-one |
|---|---|
| PubChem CID | 146008454 |
| Molecular Formula | C8H2BrF7OS |
| Molecular Weight | 359.06 g/mol |
| Exact Mass | 357.89 |
| IUPAC Name | 1-(4-bromothiophen-2-yl)-2,2,3,3,4,4,4-heptafluorobutan-1-one |
| SMILES | O=C(c1cc(Br)cs1)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H2BrF7OS/c9-3-1-4(18-2-3)5(17)6(10,11)7(12,13)8(14,15)16/h1-2H |
| InChIKey | OXRDNRMKEXRVCR-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.06 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|