C12H3BrF12O — CID 146011254
1-[4-bromo-2-(trifluoromethyl)phenyl]-2,2,3,3,4,4,5,5,5-nonafluoropentan-1-one (PubChem CID 146011254) has the molecular formula C12H3BrF12O and a molecular weight of 471.04 g/mol. Its IUPAC name is 1-[4-bromo-2-(trifluoromethyl)phenyl]-2,2,3,3,4,4,5,5,5-nonafluoropentan-1-one.
| Compound Name | 1-[4-bromo-2-(trifluoromethyl)phenyl]-2,2,3,3,4,4,5,5,5-nonafluoropentan-1-one |
|---|---|
| PubChem CID | 146011254 |
| Molecular Formula | C12H3BrF12O |
| Molecular Weight | 471.04 g/mol |
| Exact Mass | 469.92 |
| IUPAC Name | 1-[4-bromo-2-(trifluoromethyl)phenyl]-2,2,3,3,4,4,5,5,5-nonafluoropentan-1-one |
| SMILES | O=C(c1ccc(Br)cc1C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H3BrF12O/c13-4-1-2-5(6(3-4)9(16,17)18)7(26)8(14,15)10(19,20)11(21,22)12(23,24)25/h1-3H |
| InChIKey | CDRVYZNGWTUSNQ-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.04 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|