C31H22BrClN2 — CID 146013730
4-(3-bromo-5-chlorophenyl)-6-(9,9-dimethylfluoren-2-yl)-2-phenylpyrimidine (PubChem CID 146013730) has the molecular formula C31H22BrClN2 and a molecular weight of 537.89 g/mol. Its IUPAC name is 4-(3-bromo-5-chlorophenyl)-6-(9,9-dimethylfluoren-2-yl)-2-phenylpyrimidine.
| Compound Name | 4-(3-bromo-5-chlorophenyl)-6-(9,9-dimethylfluoren-2-yl)-2-phenylpyrimidine |
|---|---|
| PubChem CID | 146013730 |
| Molecular Formula | C31H22BrClN2 |
| Molecular Weight | 537.89 g/mol |
| Exact Mass | 536.07 |
| IUPAC Name | 4-(3-bromo-5-chlorophenyl)-6-(9,9-dimethylfluoren-2-yl)-2-phenylpyrimidine |
| SMILES | CC1(C)c2ccccc2-c2ccc(-c3cc(-c4cc(Cl)cc(Br)c4)nc(-c4ccccc4)n3)cc21 |
| InChI | InChI=1S/C31H22BrClN2/c1-31(2)26-11-7-6-10-24(26)25-13-12-20(16-27(25)31)28-18-29(21-14-22(32)17-23(33)15-21)35-30(34-28)19-8-4-3-5-9-19/h3-18H,1-2H3 |
| InChIKey | YVNLCZQOWFGCOF-UHFFFAOYSA-N |
| XLogP | 9.20 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.89 |
| LogP ≤ 5 | 9.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |