About 5-iodo-2-methyl-1,3-thiazole
5-iodo-2-methyl-1,3-thiazole (PubChem CID 14601971) has the molecular formula C4H4INS
and a molecular weight of 225.05 g/mol. Its IUPAC name is 5-iodo-2-methyl-1,3-thiazole.
Molecular Properties
| Compound Name | 5-iodo-2-methyl-1,3-thiazole |
| PubChem CID | 14601971 |
| Molecular Formula | C4H4INS |
| Molecular Weight | 225.05 g/mol |
| Exact Mass | 224.91 |
| IUPAC Name | 5-iodo-2-methyl-1,3-thiazole |
| SMILES | Cc1ncc(I)s1 |
| InChI | InChI=1S/C4H4INS/c1-3-6-2-4(5)7-3/h2H,1H3 |
| InChIKey | WSPHZZQQZDQEPV-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.05 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 5-iodo-2-methyl-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-iodo-2-methyl-1,3-thiazole?
The IUPAC name of 5-iodo-2-methyl-1,3-thiazole (CID 14601971) is 5-iodo-2-methyl-1,3-thiazole.
What is the SMILES notation for 5-iodo-2-methyl-1,3-thiazole?
The canonical SMILES for 5-iodo-2-methyl-1,3-thiazole is Cc1ncc(I)s1.
What is the InChIKey of 5-iodo-2-methyl-1,3-thiazole?
The InChIKey is WSPHZZQQZDQEPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4INS/c1-3-6-2-4(5)7-3/h2H,1H3.
What are the key properties of 5-iodo-2-methyl-1,3-thiazole?
5-iodo-2-methyl-1,3-thiazole has a molecular weight of 225.05 g/mol, XLogP of 2.06, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-iodo-2-methyl-1,3-thiazole is sourced from PubChem (CID 14601971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).