C30H36N2O3S — CID 146019986
methyl (7bS,11R)-2-[(2-methoxyphenyl)methylamino]-7b,11-dimethyl-5-propan-2-yl-8,9,10,11a-tetrahydrophenanthro[9,10-d][1,3]thiazole-11-carboxylate (PubChem CID 146019986) has the molecular formula C30H36N2O3S and a molecular weight of 504.70 g/mol. Its IUPAC name is methyl (7bS,11R)-2-[(2-methoxyphenyl)methylamino]-7b,11-dimethyl-5-propan-2-yl-8,9,10,11a-tetrahydrophenanthro[9,10-d][1,3]thiazole-11-carboxylate.
| Compound Name | methyl (7bS,11R)-2-[(2-methoxyphenyl)methylamino]-7b,11-dimethyl-5-propan-2-yl-8,9,10,11a-tetrahydrophenanthro[9,10-d][1,3]thiazole-11-carboxylate |
|---|---|
| PubChem CID | 146019986 |
| Molecular Formula | C30H36N2O3S |
| Molecular Weight | 504.70 g/mol |
| Exact Mass | 504.24 |
| IUPAC Name | methyl (7bS,11R)-2-[(2-methoxyphenyl)methylamino]-7b,11-dimethyl-5-propan-2-yl-8,9,10,11a-tetrahydrophenanthro[9,10-d][1,3]thiazole-11-carboxylate |
| SMILES | COC(=O)[C@]1(C)CCC[C@]2(C)c3ccc(C(C)C)cc3-c3nc(NCc4ccccc4OC)sc3C12 |
| InChI | InChI=1S/C30H36N2O3S/c1-18(2)19-12-13-22-21(16-19)24-25(26-29(22,3)14-9-15-30(26,4)27(33)35-6)36-28(32-24)31-17-20-10-7-8-11-23(20)34-5/h7-8,10-13,16,18,26H,9,14-15,17H2,1-6H3,(H,31,32)/t26?,29-,30-/m1/s1 |
| InChIKey | UTDGRNQMZGPRFW-FHSDPKPXSA-N |
| XLogP | 7.27 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.70 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |