C32H58O13 — CID 146020015
[(3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl] 5-hydroxy-2-(1-hydroxyoctyl)-3-oxo-2-[(3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]dodecanoate (PubChem CID 146020015) has the molecular formula C32H58O13 and a molecular weight of 650.80 g/mol. Its IUPAC name is [(3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl] 5-hydroxy-2-(1-hydroxyoctyl)-3-oxo-2-[(3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]dodecanoate.
| Compound Name | [(3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl] 5-hydroxy-2-(1-hydroxyoctyl)-3-oxo-2-[(3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]dodecanoate |
|---|---|
| PubChem CID | 146020015 |
| Molecular Formula | C32H58O13 |
| Molecular Weight | 650.80 g/mol |
| Exact Mass | 650.39 |
| IUPAC Name | [(3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl] 5-hydroxy-2-(1-hydroxyoctyl)-3-oxo-2-[(3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]dodecanoate |
| SMILES | CCCCCCCC(O)CC(=O)C(C(=O)OC1O[C@@H](C)[C@H](O)[C@@H](O)[C@H]1O)(C(O)CCCCCCC)C1O[C@@H](C)[C@H](O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C32H58O13/c1-5-7-9-11-13-15-20(33)17-22(35)32(21(34)16-14-12-10-8-6-2,29-27(40)25(38)23(36)18(3)43-29)31(42)45-30-28(41)26(39)24(37)19(4)44-30/h18-21,23-30,33-34,36-41H,5-17H2,1-4H3/t18-,19-,20?,21?,23-,24-,25+,26+,27+,28+,29?,30?,32?/m0/s1 |
| InChIKey | PPNCQXCFWIWCTR-GFMUKLRQSA-N |
| XLogP | 0.62 |
| TPSA | 223.67 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.80 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|