C15H30O3Si — CID 146021279
(4S,5S)-4-butyl-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-one (PubChem CID 146021279) has the molecular formula C15H30O3Si and a molecular weight of 286.49 g/mol. Its IUPAC name is (4S,5S)-4-butyl-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-one.
| Compound Name | (4S,5S)-4-butyl-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-one |
|---|---|
| PubChem CID | 146021279 |
| Molecular Formula | C15H30O3Si |
| Molecular Weight | 286.49 g/mol |
| Exact Mass | 286.20 |
| IUPAC Name | (4S,5S)-4-butyl-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-one |
| SMILES | CCCC[C@H]1CC(=O)O[C@@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H30O3Si/c1-7-8-9-12-10-14(16)18-13(12)11-17-19(5,6)15(2,3)4/h12-13H,7-11H2,1-6H3/t12-,13+/m0/s1 |
| InChIKey | UIIYGWVRIDUFHR-QWHCGFSZSA-N |
| XLogP | 4.13 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.49 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|