C14H26O3Si — CID 57379408
(1S,4S,5R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-methyl-3-oxabicyclo[3.2.0]heptan-2-one (PubChem CID 57379408) has the molecular formula C14H26O3Si and a molecular weight of 270.44 g/mol. Its IUPAC name is (1S,4S,5R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-methyl-3-oxabicyclo[3.2.0]heptan-2-one.
| Compound Name | (1S,4S,5R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-methyl-3-oxabicyclo[3.2.0]heptan-2-one |
|---|---|
| PubChem CID | 57379408 |
| Molecular Formula | C14H26O3Si |
| Molecular Weight | 270.44 g/mol |
| Exact Mass | 270.17 |
| IUPAC Name | (1S,4S,5R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-methyl-3-oxabicyclo[3.2.0]heptan-2-one |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1OC(=O)[C@H]2CC[C@]21C |
| InChI | InChI=1S/C14H26O3Si/c1-13(2,3)18(5,6)16-9-11-14(4)8-7-10(14)12(15)17-11/h10-11H,7-9H2,1-6H3/t10-,11-,14-/m1/s1 |
| InChIKey | YJDJXHPSWOGDSM-JTNHKYCSSA-N |
| XLogP | 3.35 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.44 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|