C17H30O3Si — CID 44631478
(1S,2R,6S,7R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-methyl-4-oxatricyclo[5.3.0.02,6]decan-3-one (PubChem CID 44631478) has the molecular formula C17H30O3Si and a molecular weight of 310.51 g/mol. Its IUPAC name is (1S,2R,6S,7R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-methyl-4-oxatricyclo[5.3.0.02,6]decan-3-one.
| Compound Name | (1S,2R,6S,7R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-methyl-4-oxatricyclo[5.3.0.02,6]decan-3-one |
|---|---|
| PubChem CID | 44631478 |
| Molecular Formula | C17H30O3Si |
| Molecular Weight | 310.51 g/mol |
| Exact Mass | 310.20 |
| IUPAC Name | (1S,2R,6S,7R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-methyl-4-oxatricyclo[5.3.0.02,6]decan-3-one |
| SMILES | CC(C)(C)[Si](C)(C)OCC1OC(=O)[C@@H]2[C@H]3CCC[C@H]3[C@]12C |
| InChI | InChI=1S/C17H30O3Si/c1-16(2,3)21(5,6)19-10-13-17(4)12-9-7-8-11(12)14(17)15(18)20-13/h11-14H,7-10H2,1-6H3/t11-,12+,13?,14-,17+/m0/s1 |
| InChIKey | RGPNPCKWSKBIEK-CCXVQZPBSA-N |
| XLogP | 3.99 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.51 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|