C16H24O4 — CID 14378357
[(1R,2S,3R,6R,7S)-2-methyl-5-oxo-4-oxatricyclo[5.3.0.02,6]decan-3-yl]methyl 2,2-dimethylpropanoate (PubChem CID 14378357) has the molecular formula C16H24O4 and a molecular weight of 280.36 g/mol. Its IUPAC name is [(1R,2S,3R,6R,7S)-2-methyl-5-oxo-4-oxatricyclo[5.3.0.02,6]decan-3-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [(1R,2S,3R,6R,7S)-2-methyl-5-oxo-4-oxatricyclo[5.3.0.02,6]decan-3-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 14378357 |
| Molecular Formula | C16H24O4 |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | [(1R,2S,3R,6R,7S)-2-methyl-5-oxo-4-oxatricyclo[5.3.0.02,6]decan-3-yl]methyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OC[C@@H]1OC(=O)[C@@H]2[C@H]3CCC[C@H]3[C@]12C |
| InChI | InChI=1S/C16H24O4/c1-15(2,3)14(18)19-8-11-16(4)10-7-5-6-9(10)12(16)13(17)20-11/h9-12H,5-8H2,1-4H3/t9-,10+,11-,12-,16+/m0/s1 |
| InChIKey | VGORILVMNKHJNJ-IOFNBGNJSA-N |
| XLogP | 2.55 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |