C18H22N4O5S — CID 146022875
1-[4-[3-(4-methyl-3-oxopiperazin-1-yl)azetidin-1-yl]sulfonylphenyl]pyrrolidine-2,5-dione (PubChem CID 146022875) has the molecular formula C18H22N4O5S and a molecular weight of 406.46 g/mol. Its IUPAC name is 1-[4-[3-(4-methyl-3-oxopiperazin-1-yl)azetidin-1-yl]sulfonylphenyl]pyrrolidine-2,5-dione.
| Compound Name | 1-[4-[3-(4-methyl-3-oxopiperazin-1-yl)azetidin-1-yl]sulfonylphenyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 146022875 |
| Molecular Formula | C18H22N4O5S |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | 1-[4-[3-(4-methyl-3-oxopiperazin-1-yl)azetidin-1-yl]sulfonylphenyl]pyrrolidine-2,5-dione |
| SMILES | CN1CCN(C2CN(S(=O)(=O)c3ccc(N4C(=O)CCC4=O)cc3)C2)CC1=O |
| InChI | InChI=1S/C18H22N4O5S/c1-19-8-9-20(12-18(19)25)14-10-21(11-14)28(26,27)15-4-2-13(3-5-15)22-16(23)6-7-17(22)24/h2-5,14H,6-12H2,1H3 |
| InChIKey | ZXIARJRKXHAJGY-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 98.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|