About tert-butyl N-[4-[2-[(1-carbamoylazetidin-3-yl)amino]-2-oxoethyl]-1,3-thiazol-2-yl]carbamate
tert-butyl N-[4-[2-[(1-carbamoylazetidin-3-yl)amino]-2-oxoethyl]-1,3-thiazol-2-yl]carbamate (PubChem CID 146022911) has the molecular formula C14H21N5O4S
and a molecular weight of 355.42 g/mol. Its IUPAC name is tert-butyl N-[4-[2-[(1-carbamoylazetidin-3-yl)amino]-2-oxoethyl]-1,3-thiazol-2-yl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[4-[2-[(1-carbamoylazetidin-3-yl)amino]-2-oxoethyl]-1,3-thiazol-2-yl]carbamate |
| PubChem CID | 146022911 |
| Molecular Formula | C14H21N5O4S |
| Molecular Weight | 355.42 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | tert-butyl N-[4-[2-[(1-carbamoylazetidin-3-yl)amino]-2-oxoethyl]-1,3-thiazol-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1nc(CC(=O)NC2CN(C(N)=O)C2)cs1 |
| InChI | InChI=1S/C14H21N5O4S/c1-14(2,3)23-13(22)18-12-17-8(7-24-12)4-10(20)16-9-5-19(6-9)11(15)21/h7,9H,4-6H2,1-3H3,(H2,15,21)(H,16,20)(H,17,18,22) |
| InChIKey | HFAAJFJIRKBHNO-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 126.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.42 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze tert-butyl N-[4-[2-[(1-carbamoylazetidin-3-yl)amino]-2-oxoethyl]-1,3-thiazol-2-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[4-[2-[(1-carbamoylazetidin-3-yl)amino]-2-oxoethyl]-1,3-thiazol-2-yl]carbamate?
The IUPAC name of tert-butyl N-[4-[2-[(1-carbamoylazetidin-3-yl)amino]-2-oxoethyl]-1,3-thiazol-2-yl]carbamate (CID 146022911) is tert-butyl N-[4-[2-[(1-carbamoylazetidin-3-yl)amino]-2-oxoethyl]-1,3-thiazol-2-yl]carbamate.
What is the SMILES notation for tert-butyl N-[4-[2-[(1-carbamoylazetidin-3-yl)amino]-2-oxoethyl]-1,3-thiazol-2-yl]carbamate?
The canonical SMILES for tert-butyl N-[4-[2-[(1-carbamoylazetidin-3-yl)amino]-2-oxoethyl]-1,3-thiazol-2-yl]carbamate is CC(C)(C)OC(=O)Nc1nc(CC(=O)NC2CN(C(N)=O)C2)cs1.
What is the InChIKey of tert-butyl N-[4-[2-[(1-carbamoylazetidin-3-yl)amino]-2-oxoethyl]-1,3-thiazol-2-yl]carbamate?
The InChIKey is HFAAJFJIRKBHNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21N5O4S/c1-14(2,3)23-13(22)18-12-17-8(7-24-12)4-10(20)16-9-5-19(6-9)11(15)21/h7,9H,4-6H2,1-3H3,(H2,15,21)(H,16,20)(H,17,18,22).
What are the key properties of tert-butyl N-[4-[2-[(1-carbamoylazetidin-3-yl)amino]-2-oxoethyl]-1,3-thiazol-2-yl]carbamate?
tert-butyl N-[4-[2-[(1-carbamoylazetidin-3-yl)amino]-2-oxoethyl]-1,3-thiazol-2-yl]carbamate has a molecular weight of 355.42 g/mol, XLogP of 0.91, 4 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[4-[2-[(1-carbamoylazetidin-3-yl)amino]-2-oxoethyl]-1,3-thiazol-2-yl]carbamate is sourced from PubChem (CID 146022911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).