About 3-[[2-(4,5-dimethyl-6-oxopyrimidin-1-yl)acetyl]amino]azetidine-1-carboxamide
3-[[2-(4,5-dimethyl-6-oxopyrimidin-1-yl)acetyl]amino]azetidine-1-carboxamide (PubChem CID 146022988) has the molecular formula C12H17N5O3
and a molecular weight of 279.30 g/mol. Its IUPAC name is 3-[[2-(4,5-dimethyl-6-oxopyrimidin-1-yl)acetyl]amino]azetidine-1-carboxamide.
Molecular Properties
| Compound Name | 3-[[2-(4,5-dimethyl-6-oxopyrimidin-1-yl)acetyl]amino]azetidine-1-carboxamide |
| PubChem CID | 146022988 |
| Molecular Formula | C12H17N5O3 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | 3-[[2-(4,5-dimethyl-6-oxopyrimidin-1-yl)acetyl]amino]azetidine-1-carboxamide |
| SMILES | Cc1ncn(CC(=O)NC2CN(C(N)=O)C2)c(=O)c1C |
| InChI | InChI=1S/C12H17N5O3/c1-7-8(2)14-6-17(11(7)19)5-10(18)15-9-3-16(4-9)12(13)20/h6,9H,3-5H2,1-2H3,(H2,13,20)(H,15,18) |
| InChIKey | JKICSBYGRKKCPA-UHFFFAOYSA-N |
| XLogP | -1.26 |
| TPSA | 110.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[[2-(4,5-dimethyl-6-oxopyrimidin-1-yl)acetyl]amino]azetidine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[2-(4,5-dimethyl-6-oxopyrimidin-1-yl)acetyl]amino]azetidine-1-carboxamide?
The IUPAC name of 3-[[2-(4,5-dimethyl-6-oxopyrimidin-1-yl)acetyl]amino]azetidine-1-carboxamide (CID 146022988) is 3-[[2-(4,5-dimethyl-6-oxopyrimidin-1-yl)acetyl]amino]azetidine-1-carboxamide.
What is the SMILES notation for 3-[[2-(4,5-dimethyl-6-oxopyrimidin-1-yl)acetyl]amino]azetidine-1-carboxamide?
The canonical SMILES for 3-[[2-(4,5-dimethyl-6-oxopyrimidin-1-yl)acetyl]amino]azetidine-1-carboxamide is Cc1ncn(CC(=O)NC2CN(C(N)=O)C2)c(=O)c1C.
What is the InChIKey of 3-[[2-(4,5-dimethyl-6-oxopyrimidin-1-yl)acetyl]amino]azetidine-1-carboxamide?
The InChIKey is JKICSBYGRKKCPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N5O3/c1-7-8(2)14-6-17(11(7)19)5-10(18)15-9-3-16(4-9)12(13)20/h6,9H,3-5H2,1-2H3,(H2,13,20)(H,15,18).
What are the key properties of 3-[[2-(4,5-dimethyl-6-oxopyrimidin-1-yl)acetyl]amino]azetidine-1-carboxamide?
3-[[2-(4,5-dimethyl-6-oxopyrimidin-1-yl)acetyl]amino]azetidine-1-carboxamide has a molecular weight of 279.30 g/mol, XLogP of -1.26, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[2-(4,5-dimethyl-6-oxopyrimidin-1-yl)acetyl]amino]azetidine-1-carboxamide is sourced from PubChem (CID 146022988), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).