C24H23N4O3+ — CID 146023076
N-[(E)-[4-[2-(2,3-dihydroindol-1-yl)-2-oxoethoxy]phenyl]methylideneamino]-2-pyridin-1-ium-1-ylacetamide (PubChem CID 146023076) has the molecular formula C24H23N4O3+ and a molecular weight of 415.47 g/mol. Its IUPAC name is N-[(E)-[4-[2-(2,3-dihydroindol-1-yl)-2-oxoethoxy]phenyl]methylideneamino]-2-pyridin-1-ium-1-ylacetamide.
| Compound Name | N-[(E)-[4-[2-(2,3-dihydroindol-1-yl)-2-oxoethoxy]phenyl]methylideneamino]-2-pyridin-1-ium-1-ylacetamide |
|---|---|
| PubChem CID | 146023076 |
| Molecular Formula | C24H23N4O3+ |
| Molecular Weight | 415.47 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | N-[(E)-[4-[2-(2,3-dihydroindol-1-yl)-2-oxoethoxy]phenyl]methylideneamino]-2-pyridin-1-ium-1-ylacetamide |
| SMILES | O=C(C[n+]1ccccc1)N/N=C/c1ccc(OCC(=O)N2CCc3ccccc32)cc1 |
| InChI | InChI=1S/C24H22N4O3/c29-23(17-27-13-4-1-5-14-27)26-25-16-19-8-10-21(11-9-19)31-18-24(30)28-15-12-20-6-2-3-7-22(20)28/h1-11,13-14,16H,12,15,17-18H2/p+1/b25-16+ |
| InChIKey | DROZNAGKWKKULV-PCLIKHOPSA-O |
| XLogP | 2.09 |
| TPSA | 74.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.47 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|