C17H10FN3O4S — CID 146023437
(4E)-4-[(4-fluorophenyl)-hydroxymethylidene]-5-(furan-2-yl)-1-(1,3,4-thiadiazol-2-yl)pyrrolidine-2,3-dione (PubChem CID 146023437) has the molecular formula C17H10FN3O4S and a molecular weight of 371.35 g/mol. Its IUPAC name is (4E)-4-[(4-fluorophenyl)-hydroxymethylidene]-5-(furan-2-yl)-1-(1,3,4-thiadiazol-2-yl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[(4-fluorophenyl)-hydroxymethylidene]-5-(furan-2-yl)-1-(1,3,4-thiadiazol-2-yl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 146023437 |
| Molecular Formula | C17H10FN3O4S |
| Molecular Weight | 371.35 g/mol |
| Exact Mass | 371.04 |
| IUPAC Name | (4E)-4-[(4-fluorophenyl)-hydroxymethylidene]-5-(furan-2-yl)-1-(1,3,4-thiadiazol-2-yl)pyrrolidine-2,3-dione |
| SMILES | O=C1C(=O)N(c2nncs2)C(c2ccco2)/C1=C(\O)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H10FN3O4S/c18-10-5-3-9(4-6-10)14(22)12-13(11-2-1-7-25-11)21(16(24)15(12)23)17-20-19-8-26-17/h1-8,13,22H/b14-12+ |
| InChIKey | KEXBLGAREILPNP-WYMLVPIESA-N |
| XLogP | 2.90 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.35 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|