C16H10FN5O3S — CID 146023327
(4E)-4-[(4-fluorophenyl)-hydroxymethylidene]-5-(1H-imidazol-5-yl)-1-(1,3,4-thiadiazol-2-yl)pyrrolidine-2,3-dione (PubChem CID 146023327) has the molecular formula C16H10FN5O3S and a molecular weight of 371.35 g/mol. Its IUPAC name is (4E)-4-[(4-fluorophenyl)-hydroxymethylidene]-5-(1H-imidazol-5-yl)-1-(1,3,4-thiadiazol-2-yl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[(4-fluorophenyl)-hydroxymethylidene]-5-(1H-imidazol-5-yl)-1-(1,3,4-thiadiazol-2-yl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 146023327 |
| Molecular Formula | C16H10FN5O3S |
| Molecular Weight | 371.35 g/mol |
| Exact Mass | 371.05 |
| IUPAC Name | (4E)-4-[(4-fluorophenyl)-hydroxymethylidene]-5-(1H-imidazol-5-yl)-1-(1,3,4-thiadiazol-2-yl)pyrrolidine-2,3-dione |
| SMILES | O=C1C(=O)N(c2nncs2)C(c2cnc[nH]2)/C1=C(\O)c1ccc(F)cc1 |
| InChI | InChI=1S/C16H10FN5O3S/c17-9-3-1-8(2-4-9)13(23)11-12(10-5-18-6-19-10)22(15(25)14(11)24)16-21-20-7-26-16/h1-7,12,23H,(H,18,19)/b13-11+ |
| InChIKey | VQAUXVADBLPHFR-ACCUITESSA-N |
| XLogP | 2.03 |
| TPSA | 112.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.35 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|