C17H11N5O5S — CID 146023979
(4E)-4-[1,3-benzodioxol-5-yl(hydroxy)methylidene]-5-(1H-imidazol-5-yl)-1-(1,3,4-thiadiazol-2-yl)pyrrolidine-2,3-dione (PubChem CID 146023979) has the molecular formula C17H11N5O5S and a molecular weight of 397.37 g/mol. Its IUPAC name is (4E)-4-[1,3-benzodioxol-5-yl(hydroxy)methylidene]-5-(1H-imidazol-5-yl)-1-(1,3,4-thiadiazol-2-yl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[1,3-benzodioxol-5-yl(hydroxy)methylidene]-5-(1H-imidazol-5-yl)-1-(1,3,4-thiadiazol-2-yl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 146023979 |
| Molecular Formula | C17H11N5O5S |
| Molecular Weight | 397.37 g/mol |
| Exact Mass | 397.05 |
| IUPAC Name | (4E)-4-[1,3-benzodioxol-5-yl(hydroxy)methylidene]-5-(1H-imidazol-5-yl)-1-(1,3,4-thiadiazol-2-yl)pyrrolidine-2,3-dione |
| SMILES | O=C1C(=O)N(c2nncs2)C(c2cnc[nH]2)/C1=C(\O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H11N5O5S/c23-14(8-1-2-10-11(3-8)27-7-26-10)12-13(9-4-18-5-19-9)22(16(25)15(12)24)17-21-20-6-28-17/h1-6,13,23H,7H2,(H,18,19)/b14-12+ |
| InChIKey | JMXGIBBJQMXJRW-WYMLVPIESA-N |
| XLogP | 1.62 |
| TPSA | 130.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.37 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|