C17H13N5O4S — CID 146023330
(4E)-4-[hydroxy-(3-methoxyphenyl)methylidene]-5-(1H-imidazol-5-yl)-1-(1,3,4-thiadiazol-2-yl)pyrrolidine-2,3-dione (PubChem CID 146023330) has the molecular formula C17H13N5O4S and a molecular weight of 383.39 g/mol. Its IUPAC name is (4E)-4-[hydroxy-(3-methoxyphenyl)methylidene]-5-(1H-imidazol-5-yl)-1-(1,3,4-thiadiazol-2-yl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[hydroxy-(3-methoxyphenyl)methylidene]-5-(1H-imidazol-5-yl)-1-(1,3,4-thiadiazol-2-yl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 146023330 |
| Molecular Formula | C17H13N5O4S |
| Molecular Weight | 383.39 g/mol |
| Exact Mass | 383.07 |
| IUPAC Name | (4E)-4-[hydroxy-(3-methoxyphenyl)methylidene]-5-(1H-imidazol-5-yl)-1-(1,3,4-thiadiazol-2-yl)pyrrolidine-2,3-dione |
| SMILES | COc1cccc(/C(O)=C2\C(=O)C(=O)N(c3nncs3)C2c2cnc[nH]2)c1 |
| InChI | InChI=1S/C17H13N5O4S/c1-26-10-4-2-3-9(5-10)14(23)12-13(11-6-18-7-19-11)22(16(25)15(12)24)17-21-20-8-27-17/h2-8,13,23H,1H3,(H,18,19)/b14-12+ |
| InChIKey | WWDZCGSYBUXBIE-WYMLVPIESA-N |
| XLogP | 1.90 |
| TPSA | 121.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.39 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|