C21H16N2O5S — CID 3370866
4-[hydroxy-(3-methoxyphenyl)methylidene]-5-(3-hydroxyphenyl)-1-(1,3-thiazol-2-yl)pyrrolidine-2,3-dione (PubChem CID 3370866) has the molecular formula C21H16N2O5S and a molecular weight of 408.44 g/mol. Its IUPAC name is 4-[hydroxy-(3-methoxyphenyl)methylidene]-5-(3-hydroxyphenyl)-1-(1,3-thiazol-2-yl)pyrrolidine-2,3-dione.
| Compound Name | 4-[hydroxy-(3-methoxyphenyl)methylidene]-5-(3-hydroxyphenyl)-1-(1,3-thiazol-2-yl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 3370866 |
| Molecular Formula | C21H16N2O5S |
| Molecular Weight | 408.44 g/mol |
| Exact Mass | 408.08 |
| IUPAC Name | 4-[hydroxy-(3-methoxyphenyl)methylidene]-5-(3-hydroxyphenyl)-1-(1,3-thiazol-2-yl)pyrrolidine-2,3-dione |
| SMILES | COc1cccc(C(O)=C2C(=O)C(=O)N(c3nccs3)C2c2cccc(O)c2)c1 |
| InChI | InChI=1S/C21H16N2O5S/c1-28-15-7-3-5-13(11-15)18(25)16-17(12-4-2-6-14(24)10-12)23(20(27)19(16)26)21-22-8-9-29-21/h2-11,17,24-25H,1H3 |
| InChIKey | GSBWSTLMFOFUQG-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 99.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.44 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|