C22H15F2NO5S — CID 146023712
(4E)-4-[(3,4-difluorophenyl)-hydroxymethylidene]-5-(3,4-dihydroxyphenyl)-1-(thiophen-2-ylmethyl)pyrrolidine-2,3-dione (PubChem CID 146023712) has the molecular formula C22H15F2NO5S and a molecular weight of 443.43 g/mol. Its IUPAC name is (4E)-4-[(3,4-difluorophenyl)-hydroxymethylidene]-5-(3,4-dihydroxyphenyl)-1-(thiophen-2-ylmethyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[(3,4-difluorophenyl)-hydroxymethylidene]-5-(3,4-dihydroxyphenyl)-1-(thiophen-2-ylmethyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 146023712 |
| Molecular Formula | C22H15F2NO5S |
| Molecular Weight | 443.43 g/mol |
| Exact Mass | 443.06 |
| IUPAC Name | (4E)-4-[(3,4-difluorophenyl)-hydroxymethylidene]-5-(3,4-dihydroxyphenyl)-1-(thiophen-2-ylmethyl)pyrrolidine-2,3-dione |
| SMILES | O=C1C(=O)N(Cc2cccs2)C(c2ccc(O)c(O)c2)/C1=C(\O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C22H15F2NO5S/c23-14-5-3-12(8-15(14)24)20(28)18-19(11-4-6-16(26)17(27)9-11)25(22(30)21(18)29)10-13-2-1-7-31-13/h1-9,19,26-28H,10H2/b20-18+ |
| InChIKey | OHTYYAPBWZLJIV-CZIZESTLSA-N |
| XLogP | 4.06 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.43 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|