C25H21F2NO6S — CID 146024449
(4E)-4-[(3,4-difluorophenyl)-hydroxymethylidene]-1-(thiophen-2-ylmethyl)-5-(3,4,5-trimethoxyphenyl)pyrrolidine-2,3-dione (PubChem CID 146024449) has the molecular formula C25H21F2NO6S and a molecular weight of 501.51 g/mol. Its IUPAC name is (4E)-4-[(3,4-difluorophenyl)-hydroxymethylidene]-1-(thiophen-2-ylmethyl)-5-(3,4,5-trimethoxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[(3,4-difluorophenyl)-hydroxymethylidene]-1-(thiophen-2-ylmethyl)-5-(3,4,5-trimethoxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 146024449 |
| Molecular Formula | C25H21F2NO6S |
| Molecular Weight | 501.51 g/mol |
| Exact Mass | 501.11 |
| IUPAC Name | (4E)-4-[(3,4-difluorophenyl)-hydroxymethylidene]-1-(thiophen-2-ylmethyl)-5-(3,4,5-trimethoxyphenyl)pyrrolidine-2,3-dione |
| SMILES | COc1cc(C2/C(=C(\O)c3ccc(F)c(F)c3)C(=O)C(=O)N2Cc2cccs2)cc(OC)c1OC |
| InChI | InChI=1S/C25H21F2NO6S/c1-32-18-10-14(11-19(33-2)24(18)34-3)21-20(22(29)13-6-7-16(26)17(27)9-13)23(30)25(31)28(21)12-15-5-4-8-35-15/h4-11,21,29H,12H2,1-3H3/b22-20+ |
| InChIKey | ADPQWRNLRMNVPW-LSDHQDQOSA-N |
| XLogP | 4.67 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.51 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|