C20H32N4O4S — CID 146024591
2-methoxy-5-[[1-(4-methylpiperazin-1-yl)cyclohexyl]methylsulfamoyl]benzamide (PubChem CID 146024591) has the molecular formula C20H32N4O4S and a molecular weight of 424.57 g/mol. Its IUPAC name is 2-methoxy-5-[[1-(4-methylpiperazin-1-yl)cyclohexyl]methylsulfamoyl]benzamide.
| Compound Name | 2-methoxy-5-[[1-(4-methylpiperazin-1-yl)cyclohexyl]methylsulfamoyl]benzamide |
|---|---|
| PubChem CID | 146024591 |
| Molecular Formula | C20H32N4O4S |
| Molecular Weight | 424.57 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | 2-methoxy-5-[[1-(4-methylpiperazin-1-yl)cyclohexyl]methylsulfamoyl]benzamide |
| SMILES | COc1ccc(S(=O)(=O)NCC2(N3CCN(C)CC3)CCCCC2)cc1C(N)=O |
| InChI | InChI=1S/C20H32N4O4S/c1-23-10-12-24(13-11-23)20(8-4-3-5-9-20)15-22-29(26,27)16-6-7-18(28-2)17(14-16)19(21)25/h6-7,14,22H,3-5,8-13,15H2,1-2H3,(H2,21,25) |
| InChIKey | XCRKHPXPWWKRIY-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 104.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.57 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |