C18H21N5O4S — CID 146024603
1-[4-[4-(1,2,4-triazol-1-ylmethyl)piperidin-1-yl]sulfonylphenyl]pyrrolidine-2,5-dione (PubChem CID 146024603) has the molecular formula C18H21N5O4S and a molecular weight of 403.46 g/mol. Its IUPAC name is 1-[4-[4-(1,2,4-triazol-1-ylmethyl)piperidin-1-yl]sulfonylphenyl]pyrrolidine-2,5-dione.
| Compound Name | 1-[4-[4-(1,2,4-triazol-1-ylmethyl)piperidin-1-yl]sulfonylphenyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 146024603 |
| Molecular Formula | C18H21N5O4S |
| Molecular Weight | 403.46 g/mol |
| Exact Mass | 403.13 |
| IUPAC Name | 1-[4-[4-(1,2,4-triazol-1-ylmethyl)piperidin-1-yl]sulfonylphenyl]pyrrolidine-2,5-dione |
| SMILES | O=C1CCC(=O)N1c1ccc(S(=O)(=O)N2CCC(Cn3cncn3)CC2)cc1 |
| InChI | InChI=1S/C18H21N5O4S/c24-17-5-6-18(25)23(17)15-1-3-16(4-2-15)28(26,27)22-9-7-14(8-10-22)11-21-13-19-12-20-21/h1-4,12-14H,5-11H2 |
| InChIKey | ZYNRRPSCCNIMHJ-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 105.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.46 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|