C21H26N4O4S — CID 146022822
1-[4-[4-[(3,5-dimethylpyrazol-1-yl)methyl]piperidin-1-yl]sulfonylphenyl]pyrrolidine-2,5-dione (PubChem CID 146022822) has the molecular formula C21H26N4O4S and a molecular weight of 430.53 g/mol. Its IUPAC name is 1-[4-[4-[(3,5-dimethylpyrazol-1-yl)methyl]piperidin-1-yl]sulfonylphenyl]pyrrolidine-2,5-dione.
| Compound Name | 1-[4-[4-[(3,5-dimethylpyrazol-1-yl)methyl]piperidin-1-yl]sulfonylphenyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 146022822 |
| Molecular Formula | C21H26N4O4S |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | 1-[4-[4-[(3,5-dimethylpyrazol-1-yl)methyl]piperidin-1-yl]sulfonylphenyl]pyrrolidine-2,5-dione |
| SMILES | Cc1cc(C)n(CC2CCN(S(=O)(=O)c3ccc(N4C(=O)CCC4=O)cc3)CC2)n1 |
| InChI | InChI=1S/C21H26N4O4S/c1-15-13-16(2)24(22-15)14-17-9-11-23(12-10-17)30(28,29)19-5-3-18(4-6-19)25-20(26)7-8-21(25)27/h3-6,13,17H,7-12,14H2,1-2H3 |
| InChIKey | XEKXUGOMMSHRFT-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 92.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|