C22H21FN4O — CID 146024728
(2,3-dimethyl-1H-indol-7-yl)-[2-(6-fluoro-1H-benzimidazol-2-yl)pyrrolidin-1-yl]methanone (PubChem CID 146024728) has the molecular formula C22H21FN4O and a molecular weight of 376.44 g/mol. Its IUPAC name is (2,3-dimethyl-1H-indol-7-yl)-[2-(6-fluoro-1H-benzimidazol-2-yl)pyrrolidin-1-yl]methanone.
| Compound Name | (2,3-dimethyl-1H-indol-7-yl)-[2-(6-fluoro-1H-benzimidazol-2-yl)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 146024728 |
| Molecular Formula | C22H21FN4O |
| Molecular Weight | 376.44 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | (2,3-dimethyl-1H-indol-7-yl)-[2-(6-fluoro-1H-benzimidazol-2-yl)pyrrolidin-1-yl]methanone |
| SMILES | Cc1[nH]c2c(C(=O)N3CCCC3c3nc4ccc(F)cc4[nH]3)cccc2c1C |
| InChI | InChI=1S/C22H21FN4O/c1-12-13(2)24-20-15(12)5-3-6-16(20)22(28)27-10-4-7-19(27)21-25-17-9-8-14(23)11-18(17)26-21/h3,5-6,8-9,11,19,24H,4,7,10H2,1-2H3,(H,25,26) |
| InChIKey | HUSJOGYCPGNREC-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 64.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.44 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|