C19H19FN4OS — CID 70780184
[2-(6-fluoro-1H-benzimidazol-2-yl)piperidin-1-yl]-(2-methylsulfanyl-3-pyridinyl)methanone (PubChem CID 70780184) has the molecular formula C19H19FN4OS and a molecular weight of 370.45 g/mol. Its IUPAC name is [2-(6-fluoro-1H-benzimidazol-2-yl)piperidin-1-yl]-(2-methylsulfanyl-3-pyridinyl)methanone.
| Compound Name | [2-(6-fluoro-1H-benzimidazol-2-yl)piperidin-1-yl]-(2-methylsulfanyl-3-pyridinyl)methanone |
|---|---|
| PubChem CID | 70780184 |
| Molecular Formula | C19H19FN4OS |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | [2-(6-fluoro-1H-benzimidazol-2-yl)piperidin-1-yl]-(2-methylsulfanyl-3-pyridinyl)methanone |
| SMILES | CSc1ncccc1C(=O)N1CCCCC1c1nc2ccc(F)cc2[nH]1 |
| InChI | InChI=1S/C19H19FN4OS/c1-26-18-13(5-4-9-21-18)19(25)24-10-3-2-6-16(24)17-22-14-8-7-12(20)11-15(14)23-17/h4-5,7-9,11,16H,2-3,6,10H2,1H3,(H,22,23) |
| InChIKey | WBVGIUNDQGEJLY-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |