C16H20FN3OS — CID 70727782
1-[2-(6-fluoro-1H-benzimidazol-2-yl)piperidin-1-yl]-3-methylsulfanylpropan-1-one (PubChem CID 70727782) has the molecular formula C16H20FN3OS and a molecular weight of 321.42 g/mol. Its IUPAC name is 1-[2-(6-fluoro-1H-benzimidazol-2-yl)piperidin-1-yl]-3-methylsulfanylpropan-1-one.
| Compound Name | 1-[2-(6-fluoro-1H-benzimidazol-2-yl)piperidin-1-yl]-3-methylsulfanylpropan-1-one |
|---|---|
| PubChem CID | 70727782 |
| Molecular Formula | C16H20FN3OS |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | 1-[2-(6-fluoro-1H-benzimidazol-2-yl)piperidin-1-yl]-3-methylsulfanylpropan-1-one |
| SMILES | CSCCC(=O)N1CCCCC1c1nc2ccc(F)cc2[nH]1 |
| InChI | InChI=1S/C16H20FN3OS/c1-22-9-7-15(21)20-8-3-2-4-14(20)16-18-12-6-5-11(17)10-13(12)19-16/h5-6,10,14H,2-4,7-9H2,1H3,(H,18,19) |
| InChIKey | QSXFVLCTXVEGQC-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |