C18H23NO6 — CID 146025802
4-[(2S)-2-hydroxy-3-[2-(2-methoxyphenoxy)ethylamino]propoxy]benzene-1,2-diol (PubChem CID 146025802) has the molecular formula C18H23NO6 and a molecular weight of 349.38 g/mol. Its IUPAC name is 4-[(2S)-2-hydroxy-3-[2-(2-methoxyphenoxy)ethylamino]propoxy]benzene-1,2-diol.
| Compound Name | 4-[(2S)-2-hydroxy-3-[2-(2-methoxyphenoxy)ethylamino]propoxy]benzene-1,2-diol |
|---|---|
| PubChem CID | 146025802 |
| Molecular Formula | C18H23NO6 |
| Molecular Weight | 349.38 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | 4-[(2S)-2-hydroxy-3-[2-(2-methoxyphenoxy)ethylamino]propoxy]benzene-1,2-diol |
| SMILES | COc1ccccc1OCCNC[C@H](O)COc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C18H23NO6/c1-23-17-4-2-3-5-18(17)24-9-8-19-11-13(20)12-25-14-6-7-15(21)16(22)10-14/h2-7,10,13,19-22H,8-9,11-12H2,1H3/t13-/m0/s1 |
| InChIKey | IZWFJOLNDDLZBU-ZDUSSCGKSA-N |
| XLogP | 1.51 |
| TPSA | 100.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.38 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|