C31H36O5 — CID 146029822
[(3R,4R,6S,7aS)-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyran-6-yl]methanol (PubChem CID 146029822) has the molecular formula C31H36O5 and a molecular weight of 488.62 g/mol. Its IUPAC name is [(3R,4R,6S,7aS)-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyran-6-yl]methanol.
| Compound Name | [(3R,4R,6S,7aS)-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyran-6-yl]methanol |
|---|---|
| PubChem CID | 146029822 |
| Molecular Formula | C31H36O5 |
| Molecular Weight | 488.62 g/mol |
| Exact Mass | 488.26 |
| IUPAC Name | [(3R,4R,6S,7aS)-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyran-6-yl]methanol |
| SMILES | OC[C@H]1CC2[C@H](C1)OC(COCc1ccccc1)[C@H](OCc1ccccc1)[C@@H]2OCc1ccccc1 |
| InChI | InChI=1S/C31H36O5/c32-18-26-16-27-28(17-26)36-29(22-33-19-23-10-4-1-5-11-23)31(35-21-25-14-8-3-9-15-25)30(27)34-20-24-12-6-2-7-13-24/h1-15,26-32H,16-22H2/t26-,27?,28-,29?,30+,31-/m0/s1 |
| InChIKey | YCNJACFXOCFCGH-QIBBPDAQSA-N |
| XLogP | 5.16 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.62 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |