C26H27FN4O3 — CID 146030704
ethyl N-[(4aS,6S,8aR,9S)-9-[(E)-2-[5-(3-fluorophenyl)-2-pyridinyl]ethenyl]-4,4a,5,6,7,8,8a,9-octahydrobenzo[f][1,2,3]benzoxadiazol-6-yl]carbamate (PubChem CID 146030704) has the molecular formula C26H27FN4O3 and a molecular weight of 462.53 g/mol. Its IUPAC name is ethyl N-[(4aS,6S,8aR,9S)-9-[(E)-2-[5-(3-fluorophenyl)-2-pyridinyl]ethenyl]-4,4a,5,6,7,8,8a,9-octahydrobenzo[f][1,2,3]benzoxadiazol-6-yl]carbamate.
| Compound Name | ethyl N-[(4aS,6S,8aR,9S)-9-[(E)-2-[5-(3-fluorophenyl)-2-pyridinyl]ethenyl]-4,4a,5,6,7,8,8a,9-octahydrobenzo[f][1,2,3]benzoxadiazol-6-yl]carbamate |
|---|---|
| PubChem CID | 146030704 |
| Molecular Formula | C26H27FN4O3 |
| Molecular Weight | 462.53 g/mol |
| Exact Mass | 462.21 |
| IUPAC Name | ethyl N-[(4aS,6S,8aR,9S)-9-[(E)-2-[5-(3-fluorophenyl)-2-pyridinyl]ethenyl]-4,4a,5,6,7,8,8a,9-octahydrobenzo[f][1,2,3]benzoxadiazol-6-yl]carbamate |
| SMILES | CCOC(=O)N[C@H]1CC[C@@H]2[C@H](Cc3nnoc3[C@H]2/C=C/c2ccc(-c3cccc(F)c3)cn2)C1 |
| InChI | InChI=1S/C26H27FN4O3/c1-2-33-26(32)29-21-9-10-22-18(13-21)14-24-25(34-31-30-24)23(22)11-8-20-7-6-17(15-28-20)16-4-3-5-19(27)12-16/h3-8,11-12,15,18,21-23H,2,9-10,13-14H2,1H3,(H,29,32)/b11-8+/t18-,21-,22+,23-/m0/s1 |
| InChIKey | PWMIUYCGFWFKOP-UEHJOKMHSA-N |
| XLogP | 5.15 |
| TPSA | 90.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.53 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |