C27H29FN4O2 — CID 59706678
ethyl N-[(4aR,6R,8aR,9S)-9-[(E)-2-[5-(3-fluorophenyl)-2-pyridinyl]ethenyl]-4,4a,5,6,7,8,8a,9-octahydro-1H-benzo[f]indazol-6-yl]carbamate (PubChem CID 59706678) has the molecular formula C27H29FN4O2 and a molecular weight of 460.55 g/mol. Its IUPAC name is ethyl N-[(4aR,6R,8aR,9S)-9-[(E)-2-[5-(3-fluorophenyl)-2-pyridinyl]ethenyl]-4,4a,5,6,7,8,8a,9-octahydro-1H-benzo[f]indazol-6-yl]carbamate.
| Compound Name | ethyl N-[(4aR,6R,8aR,9S)-9-[(E)-2-[5-(3-fluorophenyl)-2-pyridinyl]ethenyl]-4,4a,5,6,7,8,8a,9-octahydro-1H-benzo[f]indazol-6-yl]carbamate |
|---|---|
| PubChem CID | 59706678 |
| Molecular Formula | C27H29FN4O2 |
| Molecular Weight | 460.55 g/mol |
| Exact Mass | 460.23 |
| IUPAC Name | ethyl N-[(4aR,6R,8aR,9S)-9-[(E)-2-[5-(3-fluorophenyl)-2-pyridinyl]ethenyl]-4,4a,5,6,7,8,8a,9-octahydro-1H-benzo[f]indazol-6-yl]carbamate |
| SMILES | CCOC(=O)N[C@@H]1CC[C@@H]2[C@H](Cc3cn[nH]c3[C@H]2/C=C/c2ccc(-c3cccc(F)c3)cn2)C1 |
| InChI | InChI=1S/C27H29FN4O2/c1-2-34-27(33)31-23-9-10-24-19(14-23)12-20-16-30-32-26(20)25(24)11-8-22-7-6-18(15-29-22)17-4-3-5-21(28)13-17/h3-8,11,13,15-16,19,23-25H,2,9-10,12,14H2,1H3,(H,30,32)(H,31,33)/b11-8+/t19-,23-,24-,25+/m1/s1 |
| InChIKey | FDJLZESDIDWVAP-NAOHYYJRSA-N |
| XLogP | 5.49 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.55 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |