C13H14N2 — CID 146032409
1,2-di(cyclopenta-2,4-dien-1-yl)-4,5-dihydroimidazole (PubChem CID 146032409) has the molecular formula C13H14N2 and a molecular weight of 198.27 g/mol. Its IUPAC name is 1,2-di(cyclopenta-2,4-dien-1-yl)-4,5-dihydroimidazole.
| Compound Name | 1,2-di(cyclopenta-2,4-dien-1-yl)-4,5-dihydroimidazole |
|---|---|
| PubChem CID | 146032409 |
| Molecular Formula | C13H14N2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.12 |
| IUPAC Name | 1,2-di(cyclopenta-2,4-dien-1-yl)-4,5-dihydroimidazole |
| SMILES | C1=CC(C2=NCCN2C2C=CC=C2)C=C1 |
| InChI | InChI=1S/C13H14N2/c1-2-6-11(5-1)13-14-9-10-15(13)12-7-3-4-8-12/h1-8,11-12H,9-10H2 |
| InChIKey | NBBFNDIQCKKSLA-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |