C13H15N2+ — CID 100943451
1,3-di(cyclopenta-2,4-dien-1-yl)-4,5-dihydroimidazol-1-ium (PubChem CID 100943451) has the molecular formula C13H15N2+ and a molecular weight of 199.28 g/mol. Its IUPAC name is 1,3-di(cyclopenta-2,4-dien-1-yl)-4,5-dihydroimidazol-1-ium.
| Compound Name | 1,3-di(cyclopenta-2,4-dien-1-yl)-4,5-dihydroimidazol-1-ium |
|---|---|
| PubChem CID | 100943451 |
| Molecular Formula | C13H15N2+ |
| Molecular Weight | 199.28 g/mol |
| Exact Mass | 199.12 |
| IUPAC Name | 1,3-di(cyclopenta-2,4-dien-1-yl)-4,5-dihydroimidazol-1-ium |
| SMILES | C1=CC(N2C=[N+](C3C=CC=C3)CC2)C=C1 |
| InChI | InChI=1S/C13H15N2/c1-2-6-12(5-1)14-9-10-15(11-14)13-7-3-4-8-13/h1-8,11-13H,9-10H2/q+1 |
| InChIKey | ZVCYYVFLKYGZCQ-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.28 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|