About 1-cyclopenta-2,4-dien-1-yl-4,5-dihydroimidazol-2-amine
1-cyclopenta-2,4-dien-1-yl-4,5-dihydroimidazol-2-amine (PubChem CID 141374318) has the molecular formula C8H11N3
and a molecular weight of 149.20 g/mol. Its IUPAC name is 1-cyclopenta-2,4-dien-1-yl-4,5-dihydroimidazol-2-amine.
Analyze 1-cyclopenta-2,4-dien-1-yl-4,5-dihydroimidazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopenta-2,4-dien-1-yl-4,5-dihydroimidazol-2-amine?
The IUPAC name of 1-cyclopenta-2,4-dien-1-yl-4,5-dihydroimidazol-2-amine (CID 141374318) is 1-cyclopenta-2,4-dien-1-yl-4,5-dihydroimidazol-2-amine.
What is the SMILES notation for 1-cyclopenta-2,4-dien-1-yl-4,5-dihydroimidazol-2-amine?
The canonical SMILES for 1-cyclopenta-2,4-dien-1-yl-4,5-dihydroimidazol-2-amine is NC1=NCCN1C1C=CC=C1.
What is the InChIKey of 1-cyclopenta-2,4-dien-1-yl-4,5-dihydroimidazol-2-amine?
The InChIKey is OIAWOBRBRBSNNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3/c9-8-10-5-6-11(8)7-3-1-2-4-7/h1-4,7H,5-6H2,(H2,9,10).
What are the key properties of 1-cyclopenta-2,4-dien-1-yl-4,5-dihydroimidazol-2-amine?
1-cyclopenta-2,4-dien-1-yl-4,5-dihydroimidazol-2-amine has a molecular weight of 149.20 g/mol, XLogP of 0.11, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopenta-2,4-dien-1-yl-4,5-dihydroimidazol-2-amine is sourced from PubChem (CID 141374318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).