C13H24N3+ — CID 162358298
1,3-bis[(Z)-pent-2-enyl]-4,5-dihydroimidazol-1-ium-2-amine (PubChem CID 162358298) has the molecular formula C13H24N3+ and a molecular weight of 222.36 g/mol. Its IUPAC name is 1,3-bis[(Z)-pent-2-enyl]-4,5-dihydroimidazol-1-ium-2-amine.
| Compound Name | 1,3-bis[(Z)-pent-2-enyl]-4,5-dihydroimidazol-1-ium-2-amine |
|---|---|
| PubChem CID | 162358298 |
| Molecular Formula | C13H24N3+ |
| Molecular Weight | 222.36 g/mol |
| Exact Mass | 222.20 |
| IUPAC Name | 1,3-bis[(Z)-pent-2-enyl]-4,5-dihydroimidazol-1-ium-2-amine |
| SMILES | CC/C=C\CN1CC[N+](C/C=C\CC)=C1N |
| InChI | InChI=1S/C13H23N3/c1-3-5-7-9-15-11-12-16(13(15)14)10-8-6-4-2/h5-8,14H,3-4,9-12H2,1-2H3/p+1/b7-5-,8-6- |
| InChIKey | XACGNCGGQCOTCB-SFECMWDFSA-O |
| XLogP | 1.56 |
| TPSA | 32.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.36 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|