C10H19N5 — CID 123587776
N'-(N'-propylcarbamimidoyl)-3,6-dihydro-2H-pyridine-1-carboximidamide (PubChem CID 123587776) has the molecular formula C10H19N5 and a molecular weight of 209.30 g/mol. Its IUPAC name is N'-(N'-propylcarbamimidoyl)-3,6-dihydro-2H-pyridine-1-carboximidamide.
| Compound Name | N'-(N'-propylcarbamimidoyl)-3,6-dihydro-2H-pyridine-1-carboximidamide |
|---|---|
| PubChem CID | 123587776 |
| Molecular Formula | C10H19N5 |
| Molecular Weight | 209.30 g/mol |
| Exact Mass | 209.16 |
| IUPAC Name | N'-(N'-propylcarbamimidoyl)-3,6-dihydro-2H-pyridine-1-carboximidamide |
| SMILES | CCC/N=C(\N)N=C(N)N1CC=CCC1 |
| InChI | InChI=1S/C10H19N5/c1-2-6-13-9(11)14-10(12)15-7-4-3-5-8-15/h3-4H,2,5-8H2,1H3,(H4,11,12,13,14) |
| InChIKey | ZFLRBIZGILZTDO-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 80.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.30 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|