C6H11N3 — CID 19089264
3,6-dihydro-2H-pyridine-1-carboximidamide (PubChem CID 19089264) has the molecular formula C6H11N3 and a molecular weight of 125.17 g/mol. Its IUPAC name is 3,6-dihydro-2H-pyridine-1-carboximidamide.
| Compound Name | 3,6-dihydro-2H-pyridine-1-carboximidamide |
|---|---|
| PubChem CID | 19089264 |
| Molecular Formula | C6H11N3 |
| Molecular Weight | 125.17 g/mol |
| Exact Mass | 125.10 |
| IUPAC Name | 3,6-dihydro-2H-pyridine-1-carboximidamide |
| SMILES | [H]/N=C(\N)N1CC=CCC1 |
| InChI | InChI=1S/C6H11N3/c7-6(8)9-4-2-1-3-5-9/h1-2H,3-5H2,(H3,7,8) |
| InChIKey | HIGHKFQTHJHNOS-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 125.17 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|