C9H19N3 — CID 143657701
ethane;4-methyl-3,6-dihydro-2H-pyridine-1-carboximidamide (PubChem CID 143657701) has the molecular formula C9H19N3 and a molecular weight of 169.27 g/mol. Its IUPAC name is ethane;4-methyl-3,6-dihydro-2H-pyridine-1-carboximidamide.
| Compound Name | ethane;4-methyl-3,6-dihydro-2H-pyridine-1-carboximidamide |
|---|---|
| PubChem CID | 143657701 |
| Molecular Formula | C9H19N3 |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.16 |
| IUPAC Name | ethane;4-methyl-3,6-dihydro-2H-pyridine-1-carboximidamide |
| SMILES | CC.[H]/N=C(\N)N1CC=C(C)CC1 |
| InChI | InChI=1S/C7H13N3.C2H6/c1-6-2-4-10(5-3-6)7(8)9;1-2/h2H,3-5H2,1H3,(H3,8,9);1-2H3 |
| InChIKey | XUCYCAZQLKVHJH-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|