C9H17N4Y- — CID 59878518
3-[2-(dimethylamino)ethyl]-2,5-dihydropyrrole-1-carboximidamide;yttrium (PubChem CID 59878518) has the molecular formula C9H17N4Y- and a molecular weight of 270.17 g/mol. Its IUPAC name is 3-[2-(dimethylamino)ethyl]-2,5-dihydropyrrole-1-carboximidamide;yttrium.
| Compound Name | 3-[2-(dimethylamino)ethyl]-2,5-dihydropyrrole-1-carboximidamide;yttrium |
|---|---|
| PubChem CID | 59878518 |
| Molecular Formula | C9H17N4Y- |
| Molecular Weight | 270.17 g/mol |
| Exact Mass | 270.05 |
| IUPAC Name | 3-[2-(dimethylamino)ethyl]-2,5-dihydropyrrole-1-carboximidamide;yttrium |
| SMILES | [H]/N=C(\N)N1CC=C(C[CH-]N(C)C)C1.[Y] |
| InChI | InChI=1S/C9H17N4.Y/c1-12(2)5-3-8-4-6-13(7-8)9(10)11;/h4-5H,3,6-7H2,1-2H3,(H3,10,11);/q-1; |
| InChIKey | XBGNDHYKMXOBOW-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 56.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.17 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|