C8H13N4O+ — CID 90763509
[2-(1-carbamimidoyl-2,5-dihydropyrrol-3-yl)ethylamino]methylidyneoxidanium (PubChem CID 90763509) has the molecular formula C8H13N4O+ and a molecular weight of 181.22 g/mol. Its IUPAC name is [2-(1-carbamimidoyl-2,5-dihydropyrrol-3-yl)ethylamino]methylidyneoxidanium.
| Compound Name | [2-(1-carbamimidoyl-2,5-dihydropyrrol-3-yl)ethylamino]methylidyneoxidanium |
|---|---|
| PubChem CID | 90763509 |
| Molecular Formula | C8H13N4O+ |
| Molecular Weight | 181.22 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | [2-(1-carbamimidoyl-2,5-dihydropyrrol-3-yl)ethylamino]methylidyneoxidanium |
| SMILES | [H]/N=C(\N)N1CC=C(CCNC#[O+])C1 |
| InChI | InChI=1S/C8H13N4O/c9-8(10)12-4-2-7(5-12)1-3-11-6-13/h2,11H,1,3-5H2,(H3,9,10)/q+1 |
| InChIKey | FLFFRTRRNLLMAU-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 85.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.22 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|