C8H16N4 — CID 142256089
3-[2-(methylamino)ethyl]-2,5-dihydropyrrole-1-carboximidamide (PubChem CID 142256089) has the molecular formula C8H16N4 and a molecular weight of 168.24 g/mol. Its IUPAC name is 3-[2-(methylamino)ethyl]-2,5-dihydropyrrole-1-carboximidamide.
| Compound Name | 3-[2-(methylamino)ethyl]-2,5-dihydropyrrole-1-carboximidamide |
|---|---|
| PubChem CID | 142256089 |
| Molecular Formula | C8H16N4 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.14 |
| IUPAC Name | 3-[2-(methylamino)ethyl]-2,5-dihydropyrrole-1-carboximidamide |
| SMILES | [H]/N=C(\N)N1CC=C(CCNC)C1 |
| InChI | InChI=1S/C8H16N4/c1-11-4-2-7-3-5-12(6-7)8(9)10/h3,11H,2,4-6H2,1H3,(H3,9,10) |
| InChIKey | PUAFLLSCCLXOMC-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 65.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|